[(E)-1-[3-(trifluoromethyl)phenyl]propan-2-ylideneamino] 2-chloropyridine-3-carboxylate
Modify Date: 2025-09-25 18:05:41
![[(E)-1-[3-(trifluoromethyl)phenyl]propan-2-ylideneamino] 2-chloropyridine-3-carboxylate Structure](https://image.chemsrc.com/caspic/388/38060-01-4.png)
[(E)-1-[3-(trifluoromethyl)phenyl]propan-2-ylideneamino] 2-chloropyridine-3-carboxylate structure
|
Common Name | [(E)-1-[3-(trifluoromethyl)phenyl]propan-2-ylideneamino] 2-chloropyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 38060-01-4 | Molecular Weight | 356.72700 | |
| Density | 1.327g/cm3 | Boiling Point | 436.318ºC at 760 mmHg | |
| Molecular Formula | C16H12ClF3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.678ºC | |
| Name | [(E)-1-[3-(trifluoromethyl)phenyl]propan-2-ylideneamino] 2-chloropyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 436.318ºC at 760 mmHg |
| Molecular Formula | C16H12ClF3N2O2 |
| Molecular Weight | 356.72700 |
| Flash Point | 217.678ºC |
| Exact Mass | 356.05400 |
| PSA | 51.55000 |
| LogP | 4.52920 |
| Index of Refraction | 1.538 |
| InChIKey | RWKKSSGKDOXXKB-LSHDLFTRSA-N |
| SMILES | CC(Cc1cccc(C(F)(F)F)c1)=NOC(=O)c1cccnc1Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(3-(Trifluoromethyl)phenyl)-2-propanone O-((2-chloro-3-pyridinyl)carbonyl)oxime |
| 2-Propanone,1-(3-(trifluoromethyl)phenyl)-,O-((2-chloro-3-pyridinyl)carbonyl)oxime |