Naphth[2,3-d]isoxazole-4,9-dione,3-(4-chlorophenyl)- structure
|
Common Name | Naphth[2,3-d]isoxazole-4,9-dione,3-(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 38079-04-8 | Molecular Weight | 309.70300 | |
| Density | 1.53g/cm3 | Boiling Point | 373ºC at 760 mmHg | |
| Molecular Formula | C17H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.4ºC | |
| Name | ethyl 5-hydroxy-4,7-dioxo-1-benzofuran-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 373ºC at 760 mmHg |
| Molecular Formula | C17H8ClNO3 |
| Molecular Weight | 309.70300 |
| Flash Point | 179.4ºC |
| Exact Mass | 309.01900 |
| PSA | 60.17000 |
| LogP | 3.77040 |
| Index of Refraction | 1.595 |
| InChIKey | SXWXRCPGUHMLLI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(O)C(=O)c2ccoc2C1=O |
| HS Code | 2934999090 |
|---|
|
~75%
Naphth[2,3-d]is... CAS#:38079-04-8 |
| Literature: Brahmeshwari, G.; Rao, V. Rajeswar; Rao, T. V. Padmanabha Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1995 , vol. 34, # 2 p. 139 - 140 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-[ethoxy(hydroxy)methylidene]-1-benzofuran-4,5,7(6H)-trione |
| 6-Benzofurancarboxylic acid,4,7-dihydro-5-hydroxy-4,7-dioxo-,ethyl ester |
| 3-(4-chloro-phenyl)-naphtho[2,3-d]isoxazole-4,9-dione |