N,N'-Bis(2,4,6-trinitrophenyl)-2,6-pyridinediamine structure
|
Common Name | N,N'-Bis(2,4,6-trinitrophenyl)-2,6-pyridinediamine | ||
|---|---|---|---|---|
| CAS Number | 38082-88-1 | Molecular Weight | 531.30600 | |
| Density | 1.859g/cm3 | Boiling Point | 623.3ºC at 760 mmHg | |
| Molecular Formula | C17H9N9O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.7ºC | |
| Name | 2-N,6-N-bis(2,4,6-trinitrophenyl)pyridine-2,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.859g/cm3 |
|---|---|
| Boiling Point | 623.3ºC at 760 mmHg |
| Molecular Formula | C17H9N9O12 |
| Molecular Weight | 531.30600 |
| Flash Point | 330.7ºC |
| Exact Mass | 531.03700 |
| PSA | 311.87000 |
| LogP | 7.30320 |
| Index of Refraction | 1.801 |
| InChIKey | GPFSORASRNHLMZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2cccc(Nc3c([N+](=O)[O-])cc([N+](=O)[O-])cc3[N+](=O)[O-])n2)c([N+](=O)[O-])c1 |
| HS Code | 2933399090 |
|---|
|
~78%
N,N'-Bis(2,4,6-... CAS#:38082-88-1 |
| Literature: Badgujar; Talawar; Asthana; Mahulikar Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2010 , vol. 49, # 12 p. 1675 - 1677 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-Pyridinediamine,N,N'-bis(2,4,6-trinitrophenyl) |
| 2,6-bis(2,4,6-trinitrophenylamino)-pyridine |
| 2,6-Pyridinediamine,N2,N6-bis(2,4,6-trinitrophenyl) |
| 2,6-Bis-(picrylamino)pyridin |
| N,N'-Bis(2,4,6-trinitrophenyl)-2,6-pyridinediamine |
| 2,6-bis-picrylaminopyridine |