N,N'-BIS(2,4,6-TRICHLOROPHENYL)UREA structure
|
Common Name | N,N'-BIS(2,4,6-TRICHLOROPHENYL)UREA | ||
|---|---|---|---|---|
| CAS Number | 20632-35-3 | Molecular Weight | 418.91800 | |
| Density | 1.734g/cm3 | Boiling Point | 399.7ºC at 760mmHg | |
| Molecular Formula | C13H6Cl6N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.5ºC | |
| Name | 1,3-bis(2,4,6-trichlorophenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.734g/cm3 |
|---|---|
| Boiling Point | 399.7ºC at 760mmHg |
| Molecular Formula | C13H6Cl6N2O |
| Molecular Weight | 418.91800 |
| Flash Point | 195.5ºC |
| Exact Mass | 415.86100 |
| PSA | 41.13000 |
| LogP | 7.39700 |
| Vapour Pressure | 1.34E-06mmHg at 25°C |
| Index of Refraction | 1.71 |
| InChIKey | KCPIVZYPHAUCOR-UHFFFAOYSA-N |
| SMILES | O=C(Nc1c(Cl)cc(Cl)cc1Cl)Nc1c(Cl)cc(Cl)cc1Cl |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2.4.6.2'.4'.6'-Hexachlor-carbanilid |
| Carbanilide,2,2',4,4',6,6'-hexachloro |
| N,N'-bis-(2,4,6-trichloro-phenyl)-urea |
| 2,2',4,4',6,6'-Hexachloro-N,N'-diphenylurea |
| N.N'-Bis-<2.4.6-trichlor-phenyl>-harnstoff |
| Urea,N,N'-bis(2,4,6-trichlorophenyl) |
| bis-(2,4,6-trichlorophenyl)urea |
| bis(2,4,6-trichlorodiphenyl)urea |