Benzoic acid,5-[2-[4'-[2-[2,4-diamino-5-[2-(4-sulfophenyl)diazenyl]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-2-hydroxy-,sodium salt (1:2) structure
|
Common Name | Benzoic acid,5-[2-[4'-[2-[2,4-diamino-5-[2-(4-sulfophenyl)diazenyl]phenyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-2-hydroxy-,sodium salt (1:2) | ||
|---|---|---|---|---|
| CAS Number | 3811-71-0 | Molecular Weight | 680.60100 | |
| Density | 1.51g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C31H22N8Na2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Dianil Brown 3GN |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Molecular Formula | C31H22N8Na2O6S |
| Molecular Weight | 680.60100 |
| Exact Mass | 680.11800 |
| PSA | 252.14000 |
| LogP | 8.98060 |
| Index of Refraction | 1.734 |
| InChIKey | SKZFGYYJDVHJSA-UHFFFAOYSA-L |
| SMILES | Nc1cc(N)c(N=Nc2ccc(S(=O)(=O)[O-])cc2)cc1N=Nc1ccc(-c2ccc(N=Nc3ccc(C(=O)[O-])c(O)c3)cc2)cc1.[Na+].[Na+] |
| Hazard Codes | Xi,Xn |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . R22:Harmful if swallowed. |
| Safety Phrases | S26-S36/37/39-S37/39 |
| RIDADR | UN 1989 3/PG 3 |
| WGK Germany | 3 |
| EINECS 223-294-4 |
| Direct Brown 1 |
| Diphenyl Brown GRI |
| Benzo Chrome Brown G |
| DIANIL BROWN 3GN |
| Benzamine Brown 3 GO |
| MFCD00047778 |