3-benzoylnaphthalene-2-carboxylic acid structure
|
Common Name | 3-benzoylnaphthalene-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 38119-08-3 | Molecular Weight | 276.28600 | |
| Density | 1.289g/cm3 | Boiling Point | 497.8ºC at 760mmHg | |
| Molecular Formula | C18H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269ºC | |
| Name | 3-benzoylnaphthalene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 497.8ºC at 760mmHg |
| Molecular Formula | C18H12O3 |
| Molecular Weight | 276.28600 |
| Flash Point | 269ºC |
| Exact Mass | 276.07900 |
| PSA | 54.37000 |
| LogP | 3.76900 |
| Index of Refraction | 1.678 |
| InChIKey | GDYNSPPOLCIHSP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2ccccc2cc1C(=O)c1ccccc1 |
| HS Code | 2918300090 |
|---|
|
~86%
3-benzoylnaphth... CAS#:38119-08-3 |
| Literature: Mondal, Rajib; Shah, Bipin K.; Neckers, Douglas C. Journal of Organic Chemistry, 2006 , vol. 71, # 11 p. 4085 - 4091 |
|
~%
3-benzoylnaphth... CAS#:38119-08-3 |
| Literature: Mondal, Rajib; Shah, Bipin K.; Neckers, Douglas C. Journal of Organic Chemistry, 2006 , vol. 71, # 11 p. 4085 - 4091 |
|
~%
3-benzoylnaphth... CAS#:38119-08-3 |
| Literature: Martin Helvetica Chimica Acta, 1947 , vol. 30, p. 620,624 |
|
~%
3-benzoylnaphth... CAS#:38119-08-3 |
| Literature: Martin Helvetica Chimica Acta, 1947 , vol. 30, p. 620,624 |
|
~%
Detail
|
| Literature: Martin Helvetica Chimica Acta, 1947 , vol. 30, p. 620,624 |
| Precursor 7 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 253-786-4 |
| 3-benzoyl-2-naphthalenecarboxylic acid |
| 3-Benzoyl-2-naphthalincarbonsaeure |
| 3-Benzoyl-naphthalin-2-carbonsaeure |
| 3-Benzoyl-2-naphthoic acid |
| 3-Benzoyl-<2>naphthoesaeure |