2,3-Naphthalenedicarboxylic Anhydride structure
|
Common Name | 2,3-Naphthalenedicarboxylic Anhydride | ||
|---|---|---|---|---|
| CAS Number | 716-39-2 | Molecular Weight | 198.174 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 401.9±14.0 °C at 760 mmHg | |
| Molecular Formula | C12H6O3 | Melting Point | 248 °C | |
| MSDS | N/A | Flash Point | 203.1±17.3 °C | |
| Name | 2,3-Naphthalenedicarboxylic Anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 401.9±14.0 °C at 760 mmHg |
| Melting Point | 248 °C |
| Molecular Formula | C12H6O3 |
| Molecular Weight | 198.174 |
| Flash Point | 203.1±17.3 °C |
| Exact Mass | 198.031693 |
| PSA | 43.37000 |
| LogP | 2.83 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.712 |
| InChIKey | IZJDCINIYIMFGX-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2cc3ccccc3cc21 |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2917399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00059091 |
| EINECS 211-936-6 |
| benzo[f][2]benzofuran-1,3-dione |
| Naphtho(2,3-c)furan-1,3-dione |
| Naphtho[2,3-c]furan-1,3-dione |