1-Butanol, 3-methyl-,1-(4-nitrobenzoate) structure
|
Common Name | 1-Butanol, 3-methyl-,1-(4-nitrobenzoate) | ||
|---|---|---|---|---|
| CAS Number | 38120-06-8 | Molecular Weight | 237.25200 | |
| Density | 1.154g/cm3 | Boiling Point | 348.8ºC at 760mmHg | |
| Molecular Formula | C12H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.1ºC | |
| Name | 3-methylbutyl 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 348.8ºC at 760mmHg |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25200 |
| Flash Point | 145.1ºC |
| Exact Mass | 237.10000 |
| PSA | 72.12000 |
| LogP | 3.32090 |
| Index of Refraction | 1.525 |
| InChIKey | KMOODDWVCAWHMC-UHFFFAOYSA-N |
| SMILES | CC(C)CCOC(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2916399090 |
|---|
|
~76%
1-Butanol, 3-me... CAS#:38120-06-8 |
| Literature: Kiran; Ikeda, Reiko; Sakai, Norio; Konakahara, Takeo Synthesis, 2010 , # 2 art. no. F16609SS, p. 276 - 282 |
|
~%
1-Butanol, 3-me... CAS#:38120-06-8 |
|
Literature: Vogel,A. I. Text-Book of Practical Organic Chemistry, 1. Auf. |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Nitro-benzoesaeure-isopentylester |
| 4-nitro-benzoic acid isopentyl ester |
| Isopentyl 4-nitrobenzoate |
| 1-Butanol,3-methyl-,4-nitrobenzoate |
| 3-methylbutyl p-nitrobenzoate |
| Isoamyl-4-nitrobenzoat |
| p-nitrobenzoate of 3-methyl-1-butanol |
| 4-Nitrobenzoic acid,3-methylbutyl ester |