Rifamycin B methylmorpholide structure
|
Common Name | Rifamycin B methylmorpholide | ||
|---|---|---|---|---|
| CAS Number | 38123-18-1 | Molecular Weight | 838.93600 | |
| Density | 1.34g/cm3 | Boiling Point | 969.4ºC at 760 mmHg | |
| Molecular Formula | C44H58N2O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 540.1ºC | |
| Name | Rifamycin B methylmorpholide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 969.4ºC at 760 mmHg |
| Molecular Formula | C44H58N2O14 |
| Molecular Weight | 838.93600 |
| Flash Point | 540.1ºC |
| Exact Mass | 838.38900 |
| PSA | 223.34000 |
| LogP | 4.69760 |
| Index of Refraction | 1.619 |
| InChIKey | SPBJRCNEJJZYFJ-YTISXLFXSA-N |
| SMILES | COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(cc(OCC(=O)N5CCOCC5C)c4c3C2=O)NC(=O)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C1C |
|
~%
Rifamycin B met... CAS#:38123-18-1 |
| Literature: Sensi,P. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 596 - 602 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Morpholine,4-(((1,2-dihydro-5,6,17,19,21-pentahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca(1,11,13)trienimino)naphtho(2,1-b)furan-9-yl)oxy)acetyl)-3,5-dimethyl-,21-acetate |
| Rifamycin-B-(2-methyl-morpholid) |
| Rifamycin-B-(2,6-dimethyl-morpholid) |