1-(4-Nitro-2-(trifluoromethyl)phenyl)piperazine structure
|
Common Name | 1-(4-Nitro-2-(trifluoromethyl)phenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 381242-61-1 | Molecular Weight | 275.22700 | |
| Density | 1.355g/cm3 | Boiling Point | 382.1ºC at 760mmHg | |
| Molecular Formula | C11H12F3N3O2 | Melting Point | 54-55ºC | |
| MSDS | N/A | Flash Point | 184.9ºC | |
| Name | 1-[4-nitro-2-(trifluoromethyl)phenyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.355g/cm3 |
|---|---|
| Boiling Point | 382.1ºC at 760mmHg |
| Melting Point | 54-55ºC |
| Molecular Formula | C11H12F3N3O2 |
| Molecular Weight | 275.22700 |
| Flash Point | 184.9ºC |
| Exact Mass | 275.08800 |
| PSA | 61.09000 |
| LogP | 2.94020 |
| Index of Refraction | 1.515 |
| InChIKey | KMGDPTUNJDHJFZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N2CCNCC2)c(C(F)(F)F)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933599090 |
|
~77%
1-(4-Nitro-2-(t... CAS#:381242-61-1 |
| Literature: European Journal of Medicinal Chemistry, , vol. 46, # 7 p. 3167 - 3176 |
|
~%
1-(4-Nitro-2-(t... CAS#:381242-61-1 |
| Literature: Molecules, , vol. 14, # 10 p. 4120 - 4135 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-Nitro-2-trifluoromethylphenyl)piperazine |
| n-[4-nitro-2-(trifluoromethyl)phenyl]piperazine |