Brevianamide F structure
|
Common Name | Brevianamide F | ||
|---|---|---|---|---|
| CAS Number | 38136-70-8 | Molecular Weight | 283.32500 | |
| Density | N/A | Boiling Point | 633.2°C | |
| Molecular Formula | C16H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Brevianamide FBrevianamide F , also known as cyclo-(L-Trp-L-Pro), belongs to a class of naturally occurring 2,5-diketopiperazines.Brevianamide F possess interesting breast cancer resistance protein inhibitory activity.[1] brevianamide F once used as aromatic substrate. [2] |
| Name | brevianamide F |
|---|---|
| Synonym | More Synonyms |
| Description | Brevianamide F , also known as cyclo-(L-Trp-L-Pro), belongs to a class of naturally occurring 2,5-diketopiperazines.Brevianamide F possess interesting breast cancer resistance protein inhibitory activity.[1] brevianamide F once used as aromatic substrate. [2] |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 633.2°C |
|---|---|
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.32500 |
| Exact Mass | 283.13200 |
| PSA | 68.69000 |
| LogP | 1.41360 |
| InChIKey | RYFZBPVMVYTEKZ-KBPBESRZSA-N |
| SMILES | O=C1NC(Cc2c[nH]c3ccccc23)C(=O)N2CCCC12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|
| (3S,8aS)-3-(1H-indol-3-ylmethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| Brevianamide F |
| Cyclo-L-Trp-L-Pro |
| cyclo-L-tryptophanyl-L-proline |
| Cyclo(L-Pro-L-Trp-) |