1,3-Benzenedicarboxamide,5-nitro- structure
|
Common Name | 1,3-Benzenedicarboxamide,5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 38177-07-0 | Molecular Weight | 209.15900 | |
| Density | 1.508g/cm3 | Boiling Point | 370.1ºC at 760mmHg | |
| Molecular Formula | C8H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.6ºC | |
| Name | 5-nitrobenzene-1,3-dicarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.508g/cm3 |
|---|---|
| Boiling Point | 370.1ºC at 760mmHg |
| Molecular Formula | C8H7N3O4 |
| Molecular Weight | 209.15900 |
| Flash Point | 177.6ºC |
| Exact Mass | 209.04400 |
| PSA | 133.98000 |
| LogP | 2.08420 |
| Index of Refraction | 1.651 |
| InChIKey | SDQJTJLJXCWVQR-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cc(C(N)=O)cc([N+](=O)[O-])c1 |
|
~96%
1,3-Benzenedica... CAS#:38177-07-0 |
| Literature: Zahid, Muhammad; Rosspeintner, Arnulf; Angulo, Gonzalo; Grampp, Guenter; Jacques, Patrice; Mansha, Asim Journal of Photochemistry and Photobiology A: Chemistry, 2011 , vol. 220, # 1 p. 54 - 63 |
|
~%
1,3-Benzenedica... CAS#:38177-07-0 |
| Literature: Oshima, Juro; Yoshihara, Toshitada; Tobita, Seiji Chemical Physics Letters, 2006 , vol. 423, # 4-6 p. 306 - 311 |
| 5-Nitro-1,3-benzoldicarbonsaeureamid |
| 5-Nitro-isophthalsaeure-diamid |
| 5-Nitro-1,3-benzenedicarboxamide |
| 5-nitro-isophthalic acid diamide |
| 5-nitroisophthaldiamide |
| 5-Nitroisophthalamid |