N,N-diethyl-2-(2-methoxy-4-propylphenoxy)acetamide structure
|
Common Name | N,N-diethyl-2-(2-methoxy-4-propylphenoxy)acetamide | ||
|---|---|---|---|---|
| CAS Number | 3818-71-1 | Molecular Weight | 279.37500 | |
| Density | 1.02g/cm3 | Boiling Point | 402ºC at 760 mmHg | |
| Molecular Formula | C16H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.9ºC | |
| Name | N,N-diethyl-2-(2-methoxy-4-propylphenoxy)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 402ºC at 760 mmHg |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.37500 |
| Flash Point | 196.9ºC |
| Exact Mass | 279.18300 |
| PSA | 38.77000 |
| LogP | 2.89490 |
| Index of Refraction | 1.501 |
| InChIKey | BOORGPJEETYENA-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(OCC(=O)N(CC)CC)c(OC)c1 |
| HS Code | 2924299090 |
|---|
|
~%
N,N-diethyl-2-(... CAS#:3818-71-1 |
| Literature: Major,R.T.; Ohly,K.W. J. Med. Pharm. Chem., 1961 , vol. 4, # 2 p. 317 - 326 |
|
~%
N,N-diethyl-2-(... CAS#:3818-71-1 |
| Literature: Major,R.T.; Ohly,K.W. J. Med. Pharm. Chem., 1961 , vol. 4, # 2 p. 317 - 326 |
|
~%
N,N-diethyl-2-(... CAS#:3818-71-1 |
| Literature: Major,R.T.; Ohly,K.W. J. Med. Pharm. Chem., 1961 , vol. 4, # 2 p. 317 - 326 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-Diaethyl-2-(2-methoxy-4-propylphenoxy)-acetamid |
| ACETAMIDE,N,N-DIETHYL-2-(2-METHOXY-4-PROPYLPHENOXY) |
| Propinal |
| (2-Methoxy-4-propyl-phenoxy)-essigsaeure-diethylamid |
| N,N-Dietilamidi dell'acido 2-metossi-4-propil-fenossiacetico [Italian] |