N,N-diethyl-2-(2-methoxy-4-prop-2-enyl-phenoxy)ethanamine structure
|
Common Name | N,N-diethyl-2-(2-methoxy-4-prop-2-enyl-phenoxy)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 50724-03-3 | Molecular Weight | 263.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-diethyl-2-(2-methoxy-4-prop-2-enylphenoxy)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H25NO2 |
|---|---|
| Molecular Weight | 263.37500 |
| Exact Mass | 263.18900 |
| PSA | 21.70000 |
| LogP | 3.14430 |
| InChIKey | SXWUWCAMDQLKPU-UHFFFAOYSA-N |
| SMILES | C=CCc1ccc(OCCN(CC)CC)c(OC)c1 |
| HS Code | 2922299090 |
|---|
|
~%
N,N-diethyl-2-(... CAS#:50724-03-3 |
| Literature: Einhorn Patent: DE224160 ; Full Text Show Details Einhorn Patent: DE224108 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 1088,1090 |
|
~%
N,N-diethyl-2-(... CAS#:50724-03-3 |
| Literature: Kuroda; Koyama Yakugaku Zasshi, 1943 , vol. 63, # 10 p. 529,530 Chem.Abstr., 1951 , p. 3351 |
|
~%
N,N-diethyl-2-(... CAS#:50724-03-3 |
| Literature: Hoechster Farbw. Patent: DE423031 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 15, p. 1609 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Diaethylamino-1-(2-methoxy-4-allyl-phenoxy)-aethan |
| Diaethyl-[2-(4-allyl-2-methoxy-phenoxy)-aethyl]-amin |
| 3-Methoxy-4-(2-diaethylamino-aethoxy)-1-allyl-benzol |
| O-(2-Diaethylamino-aethyl)-eugenol |
| N,N-DIETHYL-2-(2-METHOXY-4-PROP-2-ENYL-PHENOXY)ETHANAMINE |
| diethyl-[2-(4-allyl-2-methoxy-phenoxy)-ethyl]-amine |