3-chloro-N-(3-chlorobenzoyl)benzohydrazide structure
|
Common Name | 3-chloro-N-(3-chlorobenzoyl)benzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 38192-14-2 | Molecular Weight | 309.14700 | |
| Density | 1.393g/cm3 | Boiling Point | 563.6ºC at 760 mmHg | |
| Molecular Formula | C14H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.6ºC | |
| Name | 3-chloro-N'-(3-chlorobenzoyl)benzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 563.6ºC at 760 mmHg |
| Molecular Formula | C14H10Cl2N2O2 |
| Molecular Weight | 309.14700 |
| Flash Point | 294.6ºC |
| Exact Mass | 308.01200 |
| PSA | 58.20000 |
| LogP | 3.85000 |
| Index of Refraction | 1.622 |
| InChIKey | SHOGETHEQFLESV-UHFFFAOYSA-N |
| SMILES | O=C(NNC(=O)c1cccc(Cl)c1)c1cccc(Cl)c1 |
|
~56%
3-chloro-N-(3-c... CAS#:38192-14-2 |
| Literature: Hoffman, Robert V.; Kumar, Anil Journal of Organic Chemistry, 1984 , vol. 49, # 21 p. 4014 - 4017 |
|
~%
3-chloro-N-(3-c... CAS#:38192-14-2 |
| Literature: Curtius; Foerster Journal fuer Praktische Chemie (Leipzig), 1901 , vol. <2>64, p. 332 |
|
~%
3-chloro-N-(3-c... CAS#:38192-14-2 |
| Literature: Curtius; Foerster Journal fuer Praktische Chemie (Leipzig), 1901 , vol. <2>64, p. 332 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| di-3ClPhCO hydr |
| N,N'-Bis-(3-chlor-benzoyl)-hydrazin |
| N,N'-bis-(3-chloro-benzoyl)-hydrazine |
| bis(m-chlorobenzo)hydrazide |
| N,N'-Di-m-chlorbenzoylhydrazin |
| 1,2-Bis-(m-chlorbenzoyl)-hydrazine |
| 2-(3-Chlorobenzoyl)hydrazide |