1,1,3,3,3-Pentafluoro-2-trifluoromethylpropyl methyl ether structure
|
Common Name | 1,1,3,3,3-Pentafluoro-2-trifluoromethylpropyl methyl ether | ||
|---|---|---|---|---|
| CAS Number | 382-26-3 | Molecular Weight | 232.07200 | |
| Density | 1.436 g/cm3 | Boiling Point | 22.5ºC at 760 mmHg | |
| Molecular Formula | C5H4F8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 1,1,3,3,3-pentafluoro-2-(trifluoromethyl)-propyl ether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.436 g/cm3 |
|---|---|
| Boiling Point | 22.5ºC at 760 mmHg |
| Molecular Formula | C5H4F8O |
| Molecular Weight | 232.07200 |
| Exact Mass | 232.01300 |
| PSA | 9.23000 |
| LogP | 2.96640 |
| Index of Refraction | 1.283 |
| InChIKey | AQHKYFLVHBIQMS-UHFFFAOYSA-N |
| SMILES | COC(F)(F)C(C(F)(F)F)C(F)(F)F |
| Hazard Codes | T,Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37-S39 |
| HS Code | 2909199090 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Methyl 1,1,3,3,3-Pentafluoro-2-(trifluoromethyl)propyl Ether |
| 1,1,3,3,3-Pentafluoro-2-trifluoromethylpropyl methyl ether |