tris(4-ethylphenyl) phosphate structure
|
Common Name | tris(4-ethylphenyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 3820-69-7 | Molecular Weight | 410.44300 | |
| Density | 1.151g/cm3 | Boiling Point | 472.6ºC at 760mmHg | |
| Molecular Formula | C24H27O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.8ºC | |
| Name | tris(4-ethylphenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 472.6ºC at 760mmHg |
| Molecular Formula | C24H27O4P |
| Molecular Weight | 410.44300 |
| Flash Point | 252.8ºC |
| Exact Mass | 410.16500 |
| PSA | 54.57000 |
| LogP | 7.01870 |
| Index of Refraction | 1.566 |
| InChIKey | BMPBPTNLNBRGOT-UHFFFAOYSA-N |
| SMILES | CCc1ccc(OP(=O)(Oc2ccc(CC)cc2)Oc2ccc(CC)cc2)cc1 |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Tris(4-ethylphenyl)phosphate |
| Phenol,4-ethyl-,phosphate |
| EINECS 223-316-2 |
| Tri-p-ethylphenylphosphat |