2,3,4-Trifluoro-5-methoxybenzoic acid structure
|
Common Name | 2,3,4-Trifluoro-5-methoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 38233-47-5 | Molecular Weight | 206.119 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 293.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H5F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.1±25.9 °C | |
| Name | 2,3,4-Trifluoro-5-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 293.1±35.0 °C at 760 mmHg |
| Molecular Formula | C8H5F3O3 |
| Molecular Weight | 206.119 |
| Flash Point | 131.1±25.9 °C |
| Exact Mass | 206.019073 |
| PSA | 46.53000 |
| LogP | 2.36 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | CGMSFYATZQKRJY-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)c(F)c(F)c1F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Methoxy-2,3,4-trifluorobenzoic acid |
| 2,3,4-Trifluoro-5-methoxybenzoic acid |
| 2,3,4,5,6-PENTAFLUOROBENZYL CHLORIDE |
| 2,3,4-Trifluor-5-methoxybenzoesaeure |
| Benzoic acid, 2,3,4-trifluoro-5-methoxy- |
| 2,3,4-trifluoro-5-methoxy benzoic acid |