3-nitropyridine-2-thiol
Modify Date: 2026-07-27 10:11:30
3-nitropyridine-2-thiol structure
|
Common Name | 3-nitropyridine-2-thiol | ||
|---|---|---|---|---|
| CAS Number | 38240-29-8 | Molecular Weight | 156.163 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 285.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C5H4N2O2S | Melting Point | 173-174ºC | |
| MSDS | Chinese USA | Flash Point | 126.3±23.2 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 3-nitro-1H-pyridine-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 285.3±25.0 °C at 760 mmHg |
| Melting Point | 173-174ºC |
| Molecular Formula | C5H4N2O2S |
| Molecular Weight | 156.163 |
| Flash Point | 126.3±23.2 °C |
| Exact Mass | 155.999344 |
| PSA | 97.51000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | LKNPLDRVWHXGKZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc[nH]c1=S |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Phrases | 22-37/38-41 |
| Safety Phrases | 26-39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3.0 |
| HS Code | 2933399090 |
CAS#:5470-18-8
CAS#:76880-29-0
CAS#:106202-26-0
CAS#:38240-21-0| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
CYP-independent inhibition of platelet aggregation in rabbits by a mixed disulfide conjugate of clopidogrel.
Thromb. Haemost. 112(6) , 1304-11, (2014) Dual antiplatelet therapy with clopidogrel and aspirin has been the standard of care in the United States for patients with acute coronary syndromes (ACS) and/or undergoing percutaneous coronary inter... |
| 3-nitropyridine-2-thiol |
| 3-Nitro-2-pyridinethiol |
| 3-Nitro-pyridin-2-thiol |
| 3-nitro-2-mercaptopyridine |
| 3-Nitro-2(1H)-pyridinethione |
| 3-nitro-pyridine-2-thiol |
| 2-Mercapto-3-nitropyridine |
| 3-nito-2-pyridinethiol |