Benzene,1-fluoro-2-nitro-4-[(3-nitrophenyl)sulfonyl]- structure
|
Common Name | Benzene,1-fluoro-2-nitro-4-[(3-nitrophenyl)sulfonyl]- | ||
|---|---|---|---|---|
| CAS Number | 383-21-1 | Molecular Weight | 326.25700 | |
| Density | 1.586g/cm3 | Boiling Point | 528.7ºC at 760mmHg | |
| Molecular Formula | C12H7FN2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.6ºC | |
| Name | 1-fluoro-2-nitro-4-(3-nitrophenyl)sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.586g/cm3 |
|---|---|
| Boiling Point | 528.7ºC at 760mmHg |
| Molecular Formula | C12H7FN2O6S |
| Molecular Weight | 326.25700 |
| Flash Point | 273.6ºC |
| Exact Mass | 326.00100 |
| PSA | 134.16000 |
| LogP | 4.60210 |
| Index of Refraction | 1.622 |
| InChIKey | NOILFIOPNUSERX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)c2ccc(F)c([N+](=O)[O-])c2)c1 |
| HS Code | 2904909090 |
|---|
|
~%
Benzene,1-fluor... CAS#:383-21-1 |
| Literature: Zahn; Zuber Chemische Berichte, 1953 , vol. 86, p. 172,180 |
|
~%
Benzene,1-fluor... CAS#:383-21-1 |
| Literature: Zahn; Zuber Chemische Berichte, 1953 , vol. 86, p. 172,180 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-fluoro-3-nitrophenyl 3-nitrophenyl sulfone |
| Sulfone,4-fluoro-3-nitrophenyl m-nitrophenyl |
| 3,3'-Dinitro-4-fluorodiphenylsulfone |