4-Decylbenzoic acid structure
|
Common Name | 4-Decylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 38300-04-8 | Molecular Weight | 262.387 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 388.6±21.0 °C at 760 mmHg | |
| Molecular Formula | C17H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.8±16.7 °C | |
| Name | 4-Decylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 388.6±21.0 °C at 760 mmHg |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.387 |
| Flash Point | 186.8±16.7 °C |
| Exact Mass | 262.193268 |
| PSA | 37.30000 |
| LogP | 7.14 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.510 |
| InChIKey | RTRTWCIWPQFYDU-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCc1ccc(C(=O)O)cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Decylbenzoic acid |
| Benzoic acid, 4-decyl- |
| QVR D10 |