3',5'-anhydrothymidine structure
|
Common Name | 3',5'-anhydrothymidine | ||
|---|---|---|---|---|
| CAS Number | 38313-48-3 | Molecular Weight | 224.21300 | |
| Density | 1.412g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O4 | Melting Point | 189-195ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3',5'-anhydrothymidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.412g/cm3 |
|---|---|
| Melting Point | 189-195ºC |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.21300 |
| Exact Mass | 224.08000 |
| PSA | 73.32000 |
| Index of Refraction | 1.572 |
| InChIKey | OAWLMYIJZBBZTP-XLPZGREQSA-N |
| SMILES | Cc1cn(C2CC3OCC3O2)c(=O)[nH]c1=O |
|
~%
3',5'-anhydroth... CAS#:38313-48-3 |
| Literature: Viterbo, Davide; Milanesio, Marco; Pomes Hernandez, Ramon; Rodriguez Tanty, Chryslaine; Colas Gonzalez, Ivan; Sablon Carrazana, Marquiza; Duque Rodriguez, Julio Acta Crystallographica Section C: Crystal Structure Communications, 2000 , vol. 56, # 5 p. 580 - 581 |
|
~%
3',5'-anhydroth... CAS#:38313-48-3 |
| Literature: Hasegawa; Seki; Juni; Saneyoshi; Kawaguchi Journal of Pharmaceutical Sciences, 1993 , vol. 82, # 12 p. 1232 - 1236 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3',5'-anhydrothimidine |
| Thymidin,3,5'-Anhydrous |
| 3,5'-thymidine,anhydrous |
| Anhydrolhymidine |