3',5'-di-o-mesylthymidine structure
|
Common Name | 3',5'-di-o-mesylthymidine | ||
|---|---|---|---|---|
| CAS Number | 56822-33-4 | Molecular Weight | 398.40900 | |
| Density | 1.595g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O9S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3',5'-di-o-mesylthymidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.595g/cm3 |
|---|---|
| Molecular Formula | C12H18N2O9S2 |
| Molecular Weight | 398.40900 |
| Exact Mass | 398.04500 |
| PSA | 167.59000 |
| LogP | 0.61510 |
| Index of Refraction | 1.585 |
| InChIKey | JPBRYDQRCOMYRY-IVZWLZJFSA-N |
| SMILES | Cc1cn(C2CC(OS(C)(=O)=O)C(COS(C)(=O)=O)O2)c(=O)[nH]c1=O |
|
~88%
3',5'-di-o-mesy... CAS#:56822-33-4 |
| Literature: Lavandera; Fernandez; Ferrero; Gotor Journal of Organic Chemistry, 2001 , vol. 66, # 11 p. 4079 - 4082 |
|
~%
3',5'-di-o-mesy... CAS#:56822-33-4 |
| Literature: Bristol-Myers Company Patent: US4904770 A1, 1990 ; |
|
~50%
3',5'-di-o-mesy... CAS#:56822-33-4 |
| Literature: Huang; Chen; Wang; Kim; Warshaw; Armstrong; Zhu; Chou; Watanabe; Matulic-Adamic; Su; Fox; Polsky; Baron; Gold; Hardy; Zuckerman Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1640 - 1646 |
| Precursor 4 | |
|---|---|
| DownStream 9 | |
| 3',5'-di-O-mesyl thymidine |