Bimatoprost acid methyl ester structure
|
Common Name | Bimatoprost acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 38315-47-8 | Molecular Weight | 402.524 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 557.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H34O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.0±23.6 °C | |
Use of Bimatoprost acid methyl esterBimatoprost methyl ester is a prodrug of Bimatoprost (HY-B0191)[1]. |
| Name | (z)-7-[(1r,2r,3r,5s)-3,5-dihydroxy-2-((e)-(s)-3-hydroxy-5-phenyl-pent-1-enyl)-cyclopentyl]-hept-5-enoic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Bimatoprost methyl ester is a prodrug of Bimatoprost (HY-B0191)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 557.2±50.0 °C at 760 mmHg |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.524 |
| Flash Point | 184.0±23.6 °C |
| Exact Mass | 402.240631 |
| PSA | 86.99000 |
| LogP | 2.68 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | UQBYFURYGYNQLQ-FDBOBMRISA-N |
| SMILES | COC(=O)CCCC=CCC1C(O)CC(O)C1C=CC(O)CCc1ccccc1 |
| 5-Heptenoic acid, 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxy-5-phenyl-1-penten-1-yl]cyclopentyl]-, methyl ester, (5Z)- |
| Methyl (5Z)-7-{(1R,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxy-5-phenylpent-1-en-1-yl]cyclopentyl}hept-5-enoate |
| BiMatoprost Acid Methyl Ester |
| (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-((S)-(E)-3-hydroxy-5-phenylpent-1-enyl)-cyclopentyl]hept-5-enoic acid methyl ester |
| Methyl (5Z)-7-{(1R,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxy-5-phenyl-1-penten-1-yl]cyclopentyl}-5-heptenoate |
| (Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-; 2-((E)-(S)-3-hydroxy-5-phenyl-pent-; 1-enyl)-cyclopentyl]-hept-5-enoic a; cid methyl ester |
| (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-((S)-3-hydroxy-5-phenyl-pent-1-enyl)-cyclopentyl]-hept-5-enoic acid methylester |
| methyl ester of bimatoprost acid |