2,4-dichloro-1-(1-diethoxyphosphoryloxyethenyl)benzene structure
|
Common Name | 2,4-dichloro-1-(1-diethoxyphosphoryloxyethenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 38331-02-1 | Molecular Weight | 325.12500 | |
| Density | 1.29g/cm3 | Boiling Point | 383.8ºC at 760mmHg | |
| Molecular Formula | C12H15Cl2O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.4ºC | |
| Name | 1-(2,4-dichlorophenyl)ethenyl diethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 383.8ºC at 760mmHg |
| Molecular Formula | C12H15Cl2O4P |
| Molecular Weight | 325.12500 |
| Flash Point | 282.4ºC |
| Exact Mass | 324.00900 |
| PSA | 54.57000 |
| LogP | 5.16180 |
| Index of Refraction | 1.517 |
| InChIKey | IZLGBMLXOOGJMU-UHFFFAOYSA-N |
| SMILES | C=C(OP(=O)(OCC)OCC)c1ccc(Cl)cc1Cl |
| HS Code | 2919900090 |
|---|
|
~83%
2,4-dichloro-1-... CAS#:38331-02-1 |
| Literature: Koziara, Anna; Mloykowska, Barbara; Majewski, Piotr; Sledzinski, Bogdan; Zwierzak, Andrzej Polish Journal of Chemistry, 1981 , vol. 55, # 2 p. 399 - 409 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| O,O-diethyl O-<1-(2,4-dichlorophenyl)vinyl>phosphate |
| Phosphoric acid,1-(2,4-dichlorophenyl)ethenyl diethyl ester |
| Diaethyl 1-(2,4-dichlorphenyl)-vinylphosphat |
| IPO 135 |