1-[(4-chloroanilino)methyl]pyrrolidine-2,5-dione
Modify Date: 2025-11-24 17:40:41
![1-[(4-chloroanilino)methyl]pyrrolidine-2,5-dione Structure](https://image.chemsrc.com/caspic/459/38359-09-0.png)
1-[(4-chloroanilino)methyl]pyrrolidine-2,5-dione structure
|
Common Name | 1-[(4-chloroanilino)methyl]pyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 38359-09-0 | Molecular Weight | 238.67000 | |
| Density | 1.406g/cm3 | Boiling Point | 495.7ºC at 760 mmHg | |
| Molecular Formula | C11H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.6ºC | |
| Name | 1-[(4-chloroanilino)methyl]pyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.406g/cm3 |
|---|---|
| Boiling Point | 495.7ºC at 760 mmHg |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67000 |
| Flash Point | 253.6ºC |
| Exact Mass | 238.05100 |
| PSA | 49.41000 |
| LogP | 1.86930 |
| Index of Refraction | 1.639 |
| InChIKey | LYDZAHRBTXXHBT-UHFFFAOYSA-N |
| SMILES | O=C1CCC(=O)N1CNc1ccc(Cl)cc1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| f1226-0035 |
| hms549e20 |