1-[(4-ethoxyanilino)methyl]pyrrolidine-2,5-dione structure
|
Common Name | 1-[(4-ethoxyanilino)methyl]pyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 38359-10-3 | Molecular Weight | 248.27800 | |
| Density | 1.252g/cm3 | Boiling Point | 496.6ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.2ºC | |
| Name | 1-[(4-ethoxyanilino)methyl]pyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 496.6ºC at 760 mmHg |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.27800 |
| Flash Point | 254.2ºC |
| Exact Mass | 248.11600 |
| PSA | 58.64000 |
| LogP | 1.61460 |
| Index of Refraction | 1.596 |
| InChIKey | CAQBMXAOLVIIPB-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(NCN2C(=O)CCC2=O)cc1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-{[(4-ethoxyphenyl)amino]methyl}pyrrolidine-2,5-dione |
| Succinimide,N-(p-phenetidinomethyl) |
| N-p-Phenetidinomethyl-succinimid |