2-Bromo-3'-acetoxy acetophenone structure
|
Common Name | 2-Bromo-3'-acetoxy acetophenone | ||
|---|---|---|---|---|
| CAS Number | 38396-89-3 | Molecular Weight | 257.08100 | |
| Density | 1.496 | Boiling Point | 337.7ºC at 760 mmHg | |
| Molecular Formula | C10H9BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158ºC | |
| Name | [3-(2-bromoacetyl)phenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.496 |
|---|---|
| Boiling Point | 337.7ºC at 760 mmHg |
| Molecular Formula | C10H9BrO3 |
| Molecular Weight | 257.08100 |
| Flash Point | 158ºC |
| Exact Mass | 255.97400 |
| PSA | 43.37000 |
| LogP | 2.18950 |
| InChIKey | YLJZSPJKMBFLRA-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1cccc(C(=O)CBr)c1 |
| HS Code | 2915390090 |
|---|
|
~%
2-Bromo-3'-acet... CAS#:38396-89-3 |
| Literature: Zhang, Yu-Juan; Shen, Liu-Lan; Cheon, Hyae-Gyeong; Xu, Yong-Nan; Jeong, Jin-Hyun Archives of Pharmacal Research, 2014 , vol. 37, # 5 p. 588 - 599 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 1-(3-Acetoxy-phenyl)-2-brom-aethanon |
| 3'-ACETOXY-2-BROMOACETOPHENONE |
| Acetophenone,2-bromo-3'-hydroxy-,acetate (7CI) |
| 1-(3-acetoxy-phenyl)-2-bromo-ethanone |
| Ethanone,1-[3-(acetyloxy)phenyl]-2-bromo |