lithium,9H-phenanthren-9-ide structure
|
Common Name | lithium,9H-phenanthren-9-ide | ||
|---|---|---|---|---|
| CAS Number | 38399-78-9 | Molecular Weight | 184.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9Li | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | lithium,9H-phenanthren-9-ide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9Li |
|---|---|
| Molecular Weight | 184.16200 |
| Exact Mass | 184.08600 |
| LogP | 3.79320 |
| InChIKey | MBOJKYJSMHDKMZ-UHFFFAOYSA-N |
| SMILES | [Li+].[c-]1cc2ccccc2c2ccccc12 |
|
~%
lithium,9H-phen... CAS#:38399-78-9 |
| Literature: Michailow; Tschernowa Doklady Akademii Nauk SSSR, 1952 , vol. 84, p. 967,970 Chem.Abstr., 1953 , p. 3259 |
|
~%
lithium,9H-phen... CAS#:38399-78-9 |
| Literature: Shizuka, Haruo; Sato, Yoshihiro; Ueki, Yutaka; Ishikawa, Mitsuo; Kumada, Makoto Journal of the Chemical Society, Faraday Transactions 1: Physical Chemistry in Condensed Phases, 1984 , vol. 80, p. 341 - 358 |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| Lithium,9-phenanthrenyl |
| 9-lithiophenanthrene |
| 9-phenanthryl lithium |
| 9-phenanthrenyllithium |