9-phenanthrylmagnesium bromide structure
|
Common Name | 9-phenanthrylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 71112-64-6 | Molecular Weight | 281.43000 | |
| Density | 0.970 g/mL at 25ºC(lit.) | Boiling Point | 65ºC(lit.) | |
| Molecular Formula | C14H9BrMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | magnesium,9H-phenanthren-9-ide,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.970 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 65ºC(lit.) |
| Molecular Formula | C14H9BrMg |
| Molecular Weight | 281.43000 |
| Flash Point | 1 °F |
| Exact Mass | 279.97400 |
| LogP | 4.63880 |
| Appearance of Characters | Solution | Clear yellow to brown |
| InChIKey | RQYSGLNTEAQBIV-UHFFFAOYSA-M |
| SMILES | [Br-].[Mg+2].[c-]1cc2ccccc2c2ccccc12 |
| Storage condition | 2-8°C |
| Water Solubility | It reacts with water. |
| Hazard Codes | F,C,F+ |
|---|---|
| Risk Phrases | 11-14-19-22-34-40-12 |
| Safety Phrases | 16-23-26-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
|
~%
9-phenanthrylma... CAS#:71112-64-6 |
| Literature: Bulletin de la Societe Chimique de France, , vol. 2, # 7-8 p. 334 - 344 |
| 9-phenanthryl magnesium bromide |
| MFCD00672008 |
| 9-phenanthrenylmagnesium bromide |
| 9-Phenanthrylmagnesium bromide 0.5 M in Tetrahydrofuran |