1,1',1'',1'''-[9,10-Dihydro-9,10-dioxoanthracene-1,4,5,8-tetryltetrakis(imino)]tetrakis(9,10-anthraquinone) structure
|
Common Name | 1,1',1'',1'''-[9,10-Dihydro-9,10-dioxoanthracene-1,4,5,8-tetryltetrakis(imino)]tetrakis(9,10-anthraquinone) | ||
|---|---|---|---|---|
| CAS Number | 38412-17-8 | Molecular Weight | 1093.06000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C70H36N4O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9,10-Anthracenedione, 1,4,5,8-tetrakis((9,10-dihydro-9,10-dioxo-1-anthracenyl)amino) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C70H36N4O10 |
|---|---|
| Molecular Weight | 1093.06000 |
| Exact Mass | 1092.24000 |
| PSA | 218.82000 |
| LogP | 12.83000 |
| InChIKey | ACUCBKPCENSOBG-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(Nc3ccc(Nc4cccc5c4C(=O)c4ccccc4C5=O)c4c3C(=O)c3c(Nc5cccc6c5C(=O)c5ccccc5C6=O)ccc(Nc5cccc6c5C(=O)c5ccccc5C6=O)c3C4=O)cccc21 |
|
~%
1,1',1'',1'''-[... CAS#:38412-17-8 |
| Literature: Bradley; Pandit Journal of the Chemical Society, 1957 , p. 819,825 |
|
~%
1,1',1'',1'''-[... CAS#:38412-17-8 |
| Literature: Hoechster Farbw. Patent: DE262788 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 618 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1.4.5.8-Tetrakis-(anthrachinonyl-(1)-amino)-anthrachinon |
| 1,4,5,8-Tetrakis-(9,10-dioxo-9,10-dihydro-[1]anthrylamino)-anthrachinon |
| 81-40-3 |
| 1,4,5,8-tetrakis-(9,10-dioxo-9,10-dihydro-[1]anthrylamino)-anthraquinone |