1,4,5,8-Tetrachloroanthraquinone structure
|
Common Name | 1,4,5,8-Tetrachloroanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 81-58-3 | Molecular Weight | 345.99200 | |
| Density | 1.672 g/cm3 | Boiling Point | 510.7ºC at 760 mmHg | |
| Molecular Formula | C14H4Cl4O2 | Melting Point | -9ºC | |
| MSDS | N/A | Flash Point | 213.5ºC | |
| Name | 1,4,5,8-tetrachloroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.672 g/cm3 |
|---|---|
| Boiling Point | 510.7ºC at 760 mmHg |
| Melting Point | -9ºC |
| Molecular Formula | C14H4Cl4O2 |
| Molecular Weight | 345.99200 |
| Flash Point | 213.5ºC |
| Exact Mass | 343.89700 |
| PSA | 34.14000 |
| LogP | 5.07560 |
| Index of Refraction | 1.250 (20ºC) |
| InChIKey | DUJPMUKIEFLXRE-UHFFFAOYSA-N |
| SMILES | O=C1c2c(Cl)ccc(Cl)c2C(=O)c2c(Cl)ccc(Cl)c21 |
| Hazard Codes | T,Xi |
|---|---|
| Risk Phrases | R45:May cause cancer. R22:Harmful if swallowed. |
| Safety Phrases | S53-S45 |
| WGK Germany | 3 |
| RTECS | BZ6720000 |
| Packaging Group | I; II; III |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD00035801 |
| EINECS 201-362-4 |
| 1,4,5,8-tetrachloroanthracene |
| 1,4,5,8-Tetrachloranthrachinon |
| 9,1,4,5,8-tetrachloro |
| 1,4,5,8-tetrachloro-anthraquinone |
| 1,5,8-Tetrachloroanthraquinone |