1-Bromo-3,3,4,4,5,5,6,6,6-nonafluorohexane structure
|
Common Name | 1-Bromo-3,3,4,4,5,5,6,6,6-nonafluorohexane | ||
|---|---|---|---|---|
| CAS Number | 38436-14-5 | Molecular Weight | 326.98600 | |
| Density | 1.721 | Boiling Point | 128ºC | |
| Molecular Formula | C6H4BrF9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 31ºC | |
| Name | 6-bromo-1,1,1,2,2,3,3,4,4-nonafluorohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.721 |
|---|---|
| Boiling Point | 128ºC |
| Molecular Formula | C6H4BrF9 |
| Molecular Weight | 326.98600 |
| Flash Point | 31ºC |
| Exact Mass | 325.93500 |
| LogP | 4.23960 |
| Index of Refraction | 1.331 |
| InChIKey | UDFSAZKDTBRQDY-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCBr |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2903799090 |
|
~%
1-Bromo-3,3,4,4... CAS#:38436-14-5 |
| Literature: Kim,Y.K. et al. Journal of Organic Chemistry, 1973 , vol. 38, p. 1615 - 1616 |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| n-C4F9CH2CH2Br |
| PC6085Y |
| 1-Bromo-2-(perfluorobutyl)ethane |
| 6-bromo-1,1,1,2,2,3,3,4,4-nonafluoro-hexane |
| 1H,1H,2H,2H-Perfluorohexyl bromide |
| 1H,1H,2H,2H-perfluoro-n-hexyl bromide |
| 1H,1H,2H,2H-Nonafluorohexyl bromide |