4'-Amylphenyl-4-methoxybenzoate structure
|
Common Name | 4'-Amylphenyl-4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 38444-13-2 | Molecular Weight | 298.37600 | |
| Density | 1.068g/cm3 | Boiling Point | 429.7ºC at 760mmHg | |
| Molecular Formula | C19H22O3 | Melting Point | 28-42ºC | |
| MSDS | Chinese USA | Flash Point | 183.2ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | (4-pentylphenyl) 4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 429.7ºC at 760mmHg |
| Melting Point | 28-42ºC |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.37600 |
| Flash Point | 183.2ºC |
| Exact Mass | 298.15700 |
| PSA | 35.53000 |
| LogP | 4.64710 |
| Index of Refraction | 1.543 |
| InChIKey | UISXVYOLBGBYCV-UHFFFAOYSA-N |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(OC)cc2)cc1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H410 |
| Precautionary Statements | P273-P280-P305 + P351 + P338-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
| Risk Phrases | 36/38-43-50/53 |
| Safety Phrases | 26-37/39-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| HS Code | 2918990090 |
|
~%
4'-Amylphenyl-4... CAS#:38444-13-2 |
| Literature: Destrade, C.; Vinet, F.; Maelstaf, P.; Gasparoux, H. Molecular Crystals and Liquid Crystals (1969-1991), 1981 , vol. 68, p. 175 - 182 |
|
~%
4'-Amylphenyl-4... CAS#:38444-13-2 |
| Literature: Steinstraesser,R. Z. Naturforsch., B: Anorg. Chem., Org. Chem., Biochem., Biophys.,, 1972 , vol. 27, p. 774 - 779 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Pentylphenyl 4-methoxybenzoate |
| p-pentylphenyl-p'-methoxybenzoate |
| 4-n-Pentylphenyl p-anisate |
| p-Pentylphenyl p-anisate |
| Nematal 105 |
| 4-Amylphenyl 4'-methoyxbenzoate |
| 4'-n-pentylphenyl 4-methoxybenzoat |
| 4-Methoxybenzoesaeure-4-n-pentylphenylester |
| 4-n-Pentylphenyl 4'-methoxybenzoate |
| anisic acid 4-n-pentylphenyl ester |
| p-amylphenyl ester of anisic acid |