3-tert-butyl-1H-1,2,4-triazole-5-thiol structure
|
Common Name | 3-tert-butyl-1H-1,2,4-triazole-5-thiol | ||
|---|---|---|---|---|
| CAS Number | 38449-51-3 | Molecular Weight | 157.23700 | |
| Density | 1.24g/cm3 | Boiling Point | 193.5ºC at 760 mmHg | |
| Molecular Formula | C6H11N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 70.8ºC | |
| Name | 5-tert-butyl-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 193.5ºC at 760 mmHg |
| Molecular Formula | C6H11N3S |
| Molecular Weight | 157.23700 |
| Flash Point | 70.8ºC |
| Exact Mass | 157.06700 |
| PSA | 80.37000 |
| LogP | 1.39090 |
| Index of Refraction | 1.617 |
| InChIKey | HKLNUWXQCMKCNX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1nc(=S)[nH][nH]1 |
| HS Code | 2933990090 |
|---|
|
~%
3-tert-butyl-1H... CAS#:38449-51-3 |
| Literature: Australian Journal of Chemistry, , vol. 61, # 5 p. 332 - 341 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-tert-Butyl-1H-1,2,4-triazole-5-thiol |
| 3-t.-Butyl-5-mercapto-1,2,4-triazol |
| 3-tert-butyl-5-mercapto-1,2,4-triazole |
| 3-t-butyl-5-thio-1H-1,2,4-triazole |
| 5-tert-butyl-4H-1,2,4-triazole-3-thiol |
| 5-tert-butyl-2,4-dihydro-[1,2,4]triazole-3-thione |
| 3-t-butyl-5-mercapto-1,2,4-triazole |