1-[2-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]-3-(propan-2-ylamino)propan-2-ol structure
|
Common Name | 1-[2-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]-3-(propan-2-ylamino)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 38457-33-9 | Molecular Weight | 340.45800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H32N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H32N2O4 |
|---|---|
| Molecular Weight | 340.45800 |
| Exact Mass | 340.23600 |
| PSA | 82.98000 |
| LogP | 1.94380 |
| InChIKey | TZHNGSBHFRGRNZ-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(O)COc1ccccc1OCC(O)CNC(C)C |
| HS Code | 2922509090 |
|---|
|
~82%
1-[2-[2-hydroxy... CAS#:38457-33-9 |
| Literature: Gist-Brocades N.V. Patent: US3998874 A1, 1976 ; US 3998874 A |
|
~%
1-[2-[2-hydroxy... CAS#:38457-33-9 |
| Literature: Zaagsma,J.; Nauta,W.T. Journal of Medicinal Chemistry, 1974 , vol. 17, # 5 p. 507 - 513 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,1'-(2-Phenylenedioxy)bis(3-isopropylamino)-2-propanol |
| 1,1'-(o-Phenylenedioxy)bis(3-isopropylamino)-2-propanol |
| 1.1'-(o-phenylenedioxy)-bis-[3-(isopropylamino) propan-2-ol] |
| 1,1'-(o-Phenylendioxy)bis(3-isopropylamino-2-propanol) |
| 2-Propanol,1,1'-(1,2-phenylenebis(oxy))bis(3-((1-methylethyl)amino) |