3-[(3-chlorophenyl)hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carbaldehyde structure
|
Common Name | 3-[(3-chlorophenyl)hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 38501-85-8 | Molecular Weight | 260.67600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(3-chlorophenyl)hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9ClN2O2 |
|---|---|
| Molecular Weight | 260.67600 |
| Exact Mass | 260.03500 |
| PSA | 58.53000 |
| LogP | 2.44510 |
| InChIKey | FRXDOZLHJOKQPQ-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(N=Nc2cccc(Cl)c2)ccc1O |
|
~%
3-[(3-chlorophe... CAS#:38501-85-8 |
| Literature: Odabasoglu, Mustafa; Albayrak, Cigdem; Bueyuekguengoer, Orhan; Goesmann, Helmut Acta Crystallographica Section C: Crystal Structure Communications, 2003 , vol. 59, # 5 p. o234-o236 |
|
~%
3-[(3-chlorophe... CAS#:38501-85-8 |
| Literature: Halve, Anand K.; Gour, Poonam; Dubey, Rakesh; Bhadauria, Deepti; Bhaskar, Bhuwan Journal of the Indian Chemical Society, 2005 , vol. 82, # 10 p. 942 - 944 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-(3-chlorophenylazo)salicylaldehyde |
| Benzaldehyde,5-[(3-chlorophenyl)azo]-2-hydroxy |