5-(Dimethylamino)-1,3,6-trimethyluracil structure
|
Common Name | 5-(Dimethylamino)-1,3,6-trimethyluracil | ||
|---|---|---|---|---|
| CAS Number | 38507-32-3 | Molecular Weight | 197.23400 | |
| Density | 1.18g/cm3 | Boiling Point | 266.3ºC at 760 mmHg | |
| Molecular Formula | C9H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 102.3ºC | |
| Name | 5-(dimethylamino)-1,3,6-trimethylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 266.3ºC at 760 mmHg |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.23400 |
| Flash Point | 102.3ºC |
| Exact Mass | 197.11600 |
| PSA | 47.24000 |
| Index of Refraction | 1.552 |
| InChIKey | BOARLCNCVBZNNU-UHFFFAOYSA-N |
| SMILES | Cc1c(N(C)C)c(=O)n(C)c(=O)n1C |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-dimethylamino-1,3,6-trimethyl-1H-pyrimidine-2,4-dione |
| 2,4(1H,3H)-Pyrimidinedione,5-dimethylamino-1,3,6-trimethyl |
| 5-(dimethylamino)-1,3,6-trimethylpyrimidine-2,4(1h,3h)-dione |
| 5-Dimethylamino-1,3,6-trimethyluracil |
| Uracil,5-(dimethylamino)-1,3,6-trimethyl |