daphnicyclidine f structure
|
Common Name | daphnicyclidine f | ||
|---|---|---|---|---|
| CAS Number | 385384-26-9 | Molecular Weight | 397.46 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 604.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H27NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.5±31.5 °C | |
Use of daphnicyclidine fDaphnicyclidin F is a Daphniphyllum alkaloid isolated from the stem of Daphniphyllum humile[1]. |
| Name | methyl (5aS,9R,10S,11aR,11bS)-10-hydroxy-9,11b-dimethyl-14-oxo-1,2,4,5,5a,6,8,9,10,11,11a,11b-dodecahydro-10,12-methanopyrano[2',3',4':8,1]azuleno[4,5-a]indolizine-13-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Daphnicyclidin F is a Daphniphyllum alkaloid isolated from the stem of Daphniphyllum humile[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 604.7±55.0 °C at 760 mmHg |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.46 |
| Flash Point | 319.5±31.5 °C |
| Exact Mass | 397.188934 |
| PSA | 76.07000 |
| LogP | 0.85 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | CBULSUOPAXBENF-VBIFSVJFSA-N |
| SMILES | COC(=O)C1=C2CCOC3=C2C2=C1C(=O)C1(O)CC4N(CC1C)CC(CC3)C24C |
| Hazard Codes | Xi |
|---|
| 10,12-Methanopyrano[4',3',2':1,8]azuleno[4,5-a]indolizine-13-carboxylic acid, 1,2,4,5,5a,6,8,9,10,11,11a,11b-dodecahydro-10-hydroxy-9,11b-dimethyl-14-oxo-, methyl ester, (5aS,9R,10S,11aR,11bS)- |
| Methyl (2S,3R,5S,6R,10S)-5-hydroxy-2,6-dimethyl-21-oxo-14-oxa-8-azahexacyclo[11.6.1.1.0.0.0]henicosa-1(19),13(20),17-triene-18-carboxylate |