1-(Difluoromethoxy)-2,3,4,5,6-pentafluoro-benzene structure
|
Common Name | 1-(Difluoromethoxy)-2,3,4,5,6-pentafluoro-benzene | ||
|---|---|---|---|---|
| CAS Number | 3856-58-4 | Molecular Weight | 234.07100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7HF7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(Difluoromethoxy)-2,3,4,5,6-pentafluoro-benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7HF7O |
|---|---|
| Molecular Weight | 234.07100 |
| Exact Mass | 233.99200 |
| PSA | 9.23000 |
| LogP | 2.98350 |
| InChIKey | SBTSYEMMYJZFRN-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(OC(F)F)c(F)c1F |
| HS Code | 2909309090 |
|---|
|
~31%
1-(Difluorometh... CAS#:3856-58-4 |
| Literature: Chen, Qing-Yun; Wu, Sheng-Wen Journal of Fluorine Chemistry, 1989 , vol. 44, p. 433 - 440 |
|
~%
1-(Difluorometh... CAS#:3856-58-4 |
| Literature: Malyuta,N.G. et al. Tetrahedron, 1975 , vol. 31, p. 1201 - 1207 |
|
~42%
Detail
|
| Literature: Mizukado, Junji; Matsukawa, Yasuhisa; Quan, Heng-Dao; Tamura, Masanori; Sekiya, Akira Journal of Fluorine Chemistry, 2005 , vol. 126, # 3 p. 373 - 377 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Pentafluorphenoxydifluormethan |
| hexafluorophenoxyethanoyl chloride |
| 2-pentafluorophenoxyacetyl chloride |
| difluoromethoxypentafluorobenzene |
| (Pentafluorophenoxy)acetyl chloride |
| pentafluorophenoxydifluoromethane |