3-(Hydroxymethyl)-1-adamantol structure
|
Common Name | 3-(Hydroxymethyl)-1-adamantol | ||
|---|---|---|---|---|
| CAS Number | 38584-37-1 | Molecular Weight | 182.259 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 322.6±10.0 °C at 760 mmHg | |
| Molecular Formula | C11H18O2 | Melting Point | 158-162ºC | |
| MSDS | Chinese USA | Flash Point | 156.5±13.6 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3-Hydroxy-1-hydroxymethyladmantane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 322.6±10.0 °C at 760 mmHg |
| Melting Point | 158-162ºC |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.259 |
| Flash Point | 156.5±13.6 °C |
| Exact Mass | 182.130676 |
| PSA | 40.46000 |
| LogP | 0.92 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | FORAJDRXEYKDFJ-UHFFFAOYSA-N |
| SMILES | OCC12CC3CC(CC(O)(C3)C1)C2 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R41 |
| Safety Phrases | S26-S39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2906199090 |
| HS Code | 2906199090 |
|---|---|
| Summary | 2906199090. cyclanic, cyclenic or cyclotherpenic alcohols. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 3-(Hydroxymethyl)-1-adamantol |
| 1-Hydroxy-3-adamantylmethanol,3-Hydroxytricyclo[3.3.1.13,7]decane-1-methanol |
| 3-(Hydroxymethyl)-1-adamantanol |
| 3-(Hydroxymethyl)adamantan-1-ol |
| (1s,3r,5R,7S)-3-(Hydroxymethyl)-1-adamantanol |
| Tricyclo[3.3.1.1]decane-1-methanol, 3-hydroxy- |
| Tricyclo[3.3.1.1]decane-1-methanol, 3-hydroxy-, (5R,7S)- |
| 1-Hydroxy-3-(hydroxymethyl)adamantane |
| 3-hydroxyadamantylmethanol |