acetic acid,4,4-dimethylcyclohexa-1,5-dien-1-ol structure
|
Common Name | acetic acid,4,4-dimethylcyclohexa-1,5-dien-1-ol | ||
|---|---|---|---|---|
| CAS Number | 38610-74-1 | Molecular Weight | 184.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,4,4-dimethylcyclohexa-1,5-dien-1-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H16O3 |
|---|---|
| Molecular Weight | 184.23200 |
| Exact Mass | 184.11000 |
| PSA | 57.53000 |
| LogP | 2.50530 |
| InChIKey | FKTJCSOPKMHRDT-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC1(C)C=CC(O)=CC1 |
|
~70%
acetic acid,4,4... CAS#:38610-74-1 |
| Literature: Romanski, Steffen; Kraus, Birgit; Guttentag, Miguel; Schlundt, Waldemar; Ruecker, Hannelore; Adler, Andreas; Neudoerfl, Joerg-Martin; Alberto, Roger; Amslinger, Sabine; Schmalz, Hans-Guenther Dalton Transactions, 2012 , vol. 41, # 45 p. 13862 - 13875 |
|
~%
acetic acid,4,4... CAS#:38610-74-1 |
| Literature: Cook,K.L.; Waring,A.J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1973 , p. 529 - 537 |
| 1,5-Cyclohexadien-1-ol,4,4-dimethyl-,acetate |
| 2-acetoxy-5,5-dimethylcyclohexa-1,3-diene |
| 4,4-dimethylcyclohexa-1,5-dien-1-yl acetate |