Tetrakis(2,4-di-tert-butylphenyl) [1,1'-biphenyl]-4,4'-diylbis(phosphonite) structure
|
Common Name | Tetrakis(2,4-di-tert-butylphenyl) [1,1'-biphenyl]-4,4'-diylbis(phosphonite) | ||
|---|---|---|---|---|
| CAS Number | 38613-77-3 | Molecular Weight | 1031.37000 | |
| Density | N/A | Boiling Point | 854.2ºC at 760 mmHg | |
| Molecular Formula | C68H88O4P2---- | Melting Point | 75-95ºC | |
| MSDS | N/A | Flash Point | 597.4ºC | |
| Name | tetrakis(2,4-di-tert-butylphenyl) [1,1-biphenyl]-4,4'-diylbisphosphonite |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 854.2ºC at 760 mmHg |
|---|---|
| Melting Point | 75-95ºC |
| Molecular Formula | C68H88O4P2---- |
| Molecular Weight | 1031.37000 |
| Flash Point | 597.4ºC |
| Exact Mass | 1030.62000 |
| PSA | 119.42000 |
| LogP | 19.99800 |
| InChIKey | BEIOEBMXPVYLRY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OP(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c2ccc(-c3ccc(P(Oc4ccc(C(C)(C)C)cc4C(C)(C)C)Oc4ccc(C(C)(C)C)cc4C(C)(C)C)cc3)cc2)c(C(C)(C)C)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tetrakis(2,4-di-tert-butylphenyl) [1,1'-biphenyl]-4,4'-diylbis(phosphonite) |
| [4-[4-bis(2,4-ditert-butylphenoxy)phosphanylphenyl]phenyl]-bis(2,4-ditert-butylphenoxy)phosphane |