1-cyclohexyl-3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]urea structure
|
Common Name | 1-cyclohexyl-3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]urea | ||
|---|---|---|---|---|
| CAS Number | 38649-70-6 | Molecular Weight | 349.46800 | |
| Density | 1.13g/cm3 | Boiling Point | 514.2ºC at 760 mmHg | |
| Molecular Formula | C19H31N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.8ºC | |
| Name | 1-cyclohexyl-3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 514.2ºC at 760 mmHg |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.46800 |
| Flash Point | 264.8ºC |
| Exact Mass | 349.23700 |
| PSA | 86.11000 |
| LogP | 3.54680 |
| Index of Refraction | 1.555 |
| InChIKey | WWCSRBJGECHTEY-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(O)COc1ccc(NC(=O)NC2CCCCC2)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
1-cyclohexyl-3-... CAS#:38649-70-6 |
| Literature: Eckardt; Carstens; Fiedler Pharmazie, 1975 , vol. 30, # 10 p. 633 - 637 |
|
~%
1-cyclohexyl-3-... CAS#:38649-70-6 |
| Literature: Eckardt; Carstens; Fiedler Pharmazie, 1975 , vol. 30, # 10 p. 633 - 637 |
|
~%
1-cyclohexyl-3-... CAS#:38649-70-6 |
| Literature: Eckardt; Carstens; Fiedler Pharmazie, 1975 , vol. 30, # 10 p. 633 - 637 |
|
~%
1-cyclohexyl-3-... CAS#:38649-70-6 |
| Literature: Eckardt; Carstens; Fiedler Pharmazie, 1975 , vol. 30, # 10 p. 633 - 637 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-cyclohexyl-3-{4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}urea |
| N-Cyclohexyl-N'-(4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)phenyl)urea |
| Urea,N-cyclohexyl-N'-(4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)phenyl) |