2-phenyl-2-phosphono-acetic acid structure
|
Common Name | 2-phenyl-2-phosphono-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 38654-93-2 | Molecular Weight | 216.12800 | |
| Density | 1.58g/cm3 | Boiling Point | 480.7ºC at 760mmHg | |
| Molecular Formula | C8H9O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.5ºC | |
| Name | 2-phenyl-2-phosphonoacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 480.7ºC at 760mmHg |
| Molecular Formula | C8H9O5P |
| Molecular Weight | 216.12800 |
| Flash Point | 244.5ºC |
| Exact Mass | 216.01900 |
| PSA | 104.64000 |
| LogP | 0.99000 |
| Index of Refraction | 1.608 |
| InChIKey | XOAOLUVHGLODKG-UHFFFAOYSA-N |
| SMILES | O=C(O)C(c1ccccc1)P(=O)(O)O |
| HS Code | 2931900090 |
|---|
|
~%
2-phenyl-2-phos... CAS#:38654-93-2 |
| Literature: Kreutzkamp,N.; Cordes,G. Archiv der Pharmazie und Berichte der Deutschen Pharmazeutischen Gesellschaft, 1962 , vol. 295, p. 276 - 283 |
|
~%
2-phenyl-2-phos... CAS#:38654-93-2 |
| Literature: Kreutzkamp,N.; Cordes,G. Archiv der Pharmazie und Berichte der Deutschen Pharmazeutischen Gesellschaft, 1962 , vol. 295, p. 276 - 283 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Benzeneacetic acid,a-phosphono |
| 2-PHENYL-2-PHOSPHONO-ACETIC ACID |