2-phenyl-2-(4-phenylphenyl)acetic acid structure
|
Common Name | 2-phenyl-2-(4-phenylphenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 5449-50-3 | Molecular Weight | 288.34000 | |
| Density | 1.172g/cm3 | Boiling Point | 410ºC at 760 mmHg | |
| Molecular Formula | C20H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.9ºC | |
| Name | 2-phenyl-2-(4-phenylphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 410ºC at 760 mmHg |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.34000 |
| Flash Point | 215.9ºC |
| Exact Mass | 288.11500 |
| PSA | 37.30000 |
| LogP | 4.57010 |
| Index of Refraction | 1.619 |
| InChIKey | ZXVGEBRRCLVWQY-UHFFFAOYSA-N |
| SMILES | O=C(O)C(c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2916399090 |
|---|
|
~28%
2-phenyl-2-(4-p... CAS#:5449-50-3 |
| Literature: METHYLGENE INC. Patent: WO2008/122115 A1, 2008 ; Location in patent: Page/Page column 49 ; |
|
~%
2-phenyl-2-(4-p... CAS#:5449-50-3 |
| Literature: Blicke; Grier Journal of the American Chemical Society, 1943 , vol. 65, p. 1725,1727 |
|
~%
2-phenyl-2-(4-p... CAS#:5449-50-3 |
| Literature: Blicke; Grier Journal of the American Chemical Society, 1943 , vol. 65, p. 1725,1727 |
|
~%
2-phenyl-2-(4-p... CAS#:5449-50-3 |
| Literature: Blicke; Grier Journal of the American Chemical Society, 1943 , vol. 65, p. 1725,1727 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Biphenyl-4-yl-phenyl-essigsaeure |
| biphenyl-4-yl-phenyl-acetic acid |
| Phenyl-p-biphenylessigsaeure |
| Phenyl-p-xenyl-essigsaeure |
| Phenyl-o-xenyl-essigsaeure |