Boc-D-Phe-Pro-OH
Boc-D-Phe-Pro-OH structure
|
Common Name | Boc-D-Phe-Pro-OH | ||
|---|---|---|---|---|
| CAS Number | 38675-10-4 | Molecular Weight | 362.420 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 594.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H26N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.3±30.1 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | boc-d-phe-pro-oh |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 594.4±50.0 °C at 760 mmHg |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.420 |
| Flash Point | 313.3±30.1 °C |
| Exact Mass | 362.184174 |
| PSA | 95.94000 |
| LogP | 2.75 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | ZPRHVPHDENDZTP-CABCVRRESA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)O |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate structure](https://image.chemsrc.com/caspic/422/19901-50-9.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| BOC-N-Me-D-Phe-Pro |
| N-(tert-Butoxycarbonyl)-D-phenylalanyl-L-proline |
| BOC-D-PHE-L-PRO-OH |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-phenylalanyl-L-proline |
| N-tert-butoxycarbonyl-D-phenylalanyl-L-proline |
| tert-butyloxycarbonyl-D-phenylalanyl-L-proline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of boc-d-phe-pro-oh? |
| A: Molecular formula of boc-d-phe-pro-oh is C19H26N2O5. |
| Q: What is the molecular weight of boc-d-phe-pro-oh? |
| A: Molecular weight of boc-d-phe-pro-oh is 362.420. |
| Q: What are the upstream materials of boc-d-phe-pro-oh? |
| A: Related upstream materials(CAS) of boc-d-phe-pro-oh: 64471-88-1;18942-49-9;41324-66-7;16652-71-4;19901-50-9. |
| Q: What is the polar surface area (PSA) of boc-d-phe-pro-oh? |
| A: Polar surface area (PSA) of boc-d-phe-pro-oh is 95.94000. |
| Q: What are the storage conditions for boc-d-phe-pro-oh? |
| A: Storage conditions for boc-d-phe-pro-oh: 2-8°C. |
| Q: What is the CAS number of boc-d-phe-pro-oh? |
| A: CAS number of boc-d-phe-pro-oh is 38675-10-4. |
| Q: What is the InChIKey of boc-d-phe-pro-oh? |
| A: InChIKey of boc-d-phe-pro-oh is ZPRHVPHDENDZTP-CABCVRRESA-N. |
| Q: What is the LogP of boc-d-phe-pro-oh? |
| A: LogP of boc-d-phe-pro-oh is 2.75. |
| Q: What is the English name of boc-d-phe-pro-oh? |
| A: The English name of boc-d-phe-pro-oh is boc-d-phe-pro-oh. |
| Q: What is the SMILES notation of boc-d-phe-pro-oh? |
| A: SMILES notation of boc-d-phe-pro-oh is CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)O. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |