N-cyclopropyl-N-piperidin-4-yl-3-(trifluoromethyl)benzenesulfonamide structure
|
Common Name | N-cyclopropyl-N-piperidin-4-yl-3-(trifluoromethyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 387350-79-0 | Molecular Weight | 348.38400 | |
| Density | 1.39g/cm3 | Boiling Point | 437.9ºC at 760mmHg | |
| Molecular Formula | C15H19F3N2O2S | Melting Point | >195ºC | |
| MSDS | N/A | Flash Point | 218.6ºC | |
| Name | N-cyclopropyl-N-piperidin-4-yl-3-(trifluoromethyl)benzenesulfonamide |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 437.9ºC at 760mmHg |
| Melting Point | >195ºC |
| Molecular Formula | C15H19F3N2O2S |
| Molecular Weight | 348.38400 |
| Flash Point | 218.6ºC |
| Exact Mass | 348.11200 |
| PSA | 57.79000 |
| LogP | 4.02010 |
| Index of Refraction | 1.561 |
| InChIKey | NQBHDSLGAKITFX-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N(C1CCNCC1)C1CC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2935009090 |
|
~82%
N-cyclopropyl-N... CAS#:387350-79-0 |
| Literature: EURO-CELTIQUE S.A. Patent: WO2007/118853 A1, 2007 ; Location in patent: Page/Page column 155-156 ; WO 2007/118853 A1 |
|
~%
N-cyclopropyl-N... CAS#:387350-79-0 |
| Literature: EURO-CELTIQUE S.A. Patent: WO2007/118853 A1, 2007 ; Location in patent: Page/Page column 159-160 ; WO 2007/118853 A1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|