diethyl 2-prop-1-en-2-ylpropanedioate structure
|
Common Name | diethyl 2-prop-1-en-2-ylpropanedioate | ||
|---|---|---|---|---|
| CAS Number | 38806-12-1 | Molecular Weight | 200.23200 | |
| Density | 1.022g/cm3 | Boiling Point | 242.4ºC at 760 mmHg | |
| Molecular Formula | C10H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.6ºC | |
| Name | diethyl 2-prop-1-en-2-ylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.022g/cm3 |
|---|---|
| Boiling Point | 242.4ºC at 760 mmHg |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23200 |
| Flash Point | 109.6ºC |
| Exact Mass | 200.10500 |
| PSA | 52.60000 |
| LogP | 1.30490 |
| Index of Refraction | 1.438 |
| InChIKey | HMVGQYOAXPORIW-UHFFFAOYSA-N |
| SMILES | C=C(C)C(C(=O)OCC)C(=O)OCC |
| HS Code | 2917190090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Isopropenyl-malonsaeure-diaethylester |
| 2-(2-Propen)malonsaeurediaethylester |
| isopropenyl-malonic acid diethyl ester |
| diethyl prop-1-en-2-ylpropanedioate |
| 2-Methyl-propen-(2)-dicarbonsaeure-(1.1)-diaethylester |