(Triphenylphosphoranylidene)acetamide structure
|
Common Name | (Triphenylphosphoranylidene)acetamide | ||
|---|---|---|---|---|
| CAS Number | 38821-11-3 | Molecular Weight | 319.33700 | |
| Density | 1.2g/cm3 | Boiling Point | 507.8ºC at 760 mmHg | |
| Molecular Formula | C20H18NOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.9ºC | |
| Name | 2-(triphenyl-λ5-phosphanylidene)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 507.8ºC at 760 mmHg |
| Molecular Formula | C20H18NOP |
| Molecular Weight | 319.33700 |
| Flash Point | 260.9ºC |
| Exact Mass | 319.11300 |
| PSA | 52.90000 |
| LogP | 2.96830 |
| Index of Refraction | 1.638 |
| InChIKey | NKFMHVSOHCEONZ-UHFFFAOYSA-N |
| SMILES | NC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-(Triphenylphosphoranylidene)acetamide |
| Phosphonium,triphenyl-,carbamoylmethylide |
| (carbamylmethylene)triphenylphosphorane |
| Triphenylphosphonium carbamoylmethylide |
| carbamoylmethylenetriphenylphosphorane |
| triphenylphosphoranylideneacetamide |
| ACETAMIDE,2-(TRIPHENYLPHOSPHORANYLIDENE) |